ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5391-71-9 (5-bromo-3,4-dimethoxy-2-nitrophenyl)methanol |
|
| Produkt-Name | (5-bromo-3,4-dimethoxy-2-nitrophenyl)methanol |
| Englischer Name | (5-bromo-3,4-dimethoxy-2-nitrophenyl)methanol; |
| Molekulare Formel | C9H10BrNO5 |
| Molecular Weight | 292.0834 |
| InChl | InChI=1/C9H10BrNO5/c1-15-8-6(10)3-5(4-12)7(11(13)14)9(8)16-2/h3,12H,4H2,1-2H3 |
| CAS Registry Number | 5391-71-9 |
| Molecular Structure | ![]() |
| Dichte | 1.629g/cm3 |
| Siedepunkt | 409.4°C at 760 mmHg |
| Brechungsindex | 1.587 |
| Flammpunkt | 201.4°C |
| Dampfdruck | 1.95E-07mmHg at 25°C |
| MSDS | |