ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5437-89-8 4-Cyclohexyl-2-(2-cyclohexylethyl)-n-ethylbutanamid |
|
| Produkt-Name | 4-Cyclohexyl-2-(2-cyclohexylethyl)-n-ethylbutanamid |
| Synonyme | ; |
| Englischer Name | 4-cyclohexyl-2-(2-cyclohexylethyl)-N-ethylbutanamide; |
| Molekulare Formel | C20H37NO |
| Molecular Weight | 307.5139 |
| InChl | InChI=1/C20H37NO/c1-2-21-20(22)19(15-13-17-9-5-3-6-10-17)16-14-18-11-7-4-8-12-18/h17-19H,2-16H2,1H3,(H,21,22) |
| CAS Registry Number | 5437-89-8 |
| Molecular Structure | ![]() |
| Dichte | 0.926g/cm3 |
| Siedepunkt | 463.3°C at 760 mmHg |
| Brechungsindex | 1.478 |
| Flammpunkt | 286.6°C |
| Dampfdruck | 9.21E-09mmHg at 25°C |
| MSDS | |