ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5455-63-0 1-Oxo-1-(phenylamino)propan-2-yldodecanoat |
|
| Produkt-Name | 1-Oxo-1-(phenylamino)propan-2-yldodecanoat |
| Synonyme | ; |
| Englischer Name | 1-oxo-1-(phenylamino)propan-2-yl dodecanoate; |
| Molekulare Formel | C21H33NO3 |
| Molecular Weight | 347.4916 |
| InChl | InChI=1/C21H33NO3/c1-3-4-5-6-7-8-9-10-14-17-20(23)25-18(2)21(24)22-19-15-12-11-13-16-19/h11-13,15-16,18H,3-10,14,17H2,1-2H3,(H,22,24) |
| CAS Registry Number | 5455-63-0 |
| Molecular Structure | ![]() |
| Dichte | 1.019g/cm3 |
| Siedepunkt | 494.5°C at 760 mmHg |
| Brechungsindex | 1.513 |
| Flammpunkt | 252.9°C |
| Dampfdruck | 6.41E-10mmHg at 25°C |
| MSDS | |