ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54778-21-1 2-Chlor-1-methyl-1H-indol-3-carbonsäure |
|
| Produkt-Name | 2-Chlor-1-methyl-1H-indol-3-carbonsäure |
| Synonyme | 1H-Indol-3-carbonsäure, 2-Chlor-1-methyl-; 2-Chlor-1-methyl-1H-indol-3-carbonsäure; |
| Englischer Name | 2-chloro-1-methyl-1H-indole-3-carboxylic acid;1H-indole-3-carboxylic acid, 2-chloro-1-methyl-;2-Chloro-1-methyl-1H-indole-3-carboxylic acid |
| Molekulare Formel | C10H8ClNO2 |
| Molecular Weight | 209.629 |
| InChl | InChI=1/C10H8ClNO2/c1-12-7-5-3-2-4-6(7)8(9(12)11)10(13)14/h2-5H,1H3,(H,13,14) |
| CAS Registry Number | 54778-21-1 |
| Molecular Structure | ![]() |
| Dichte | 1.39g/cm3 |
| Siedepunkt | 407.7°C at 760 mmHg |
| Brechungsindex | 1.631 |
| Flammpunkt | 200.4°C |
| Dampfdruck | 2.23E-07mmHg at 25°C |
| MSDS | |