ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57989-42-1 2-Chlor-1-methyl-1H-indol-3-carbaldehyd-thiosemicarbazon |
|
| Produkt-Name | 2-Chlor-1-methyl-1H-indol-3-carbaldehyd-thiosemicarbazon |
| Englischer Name | 2-chloro-1-methyl-1H-indole-3-carbaldehyde thiosemicarbazone; |
| Molekulare Formel | C11H11ClN4S |
| Molecular Weight | 266.7498 |
| InChl | InChI=1/C11H11ClN4S/c1-16-9-5-3-2-4-7(9)8(10(16)12)6-14-15-11(13)17/h2-6H,1H3,(H3,13,15,17) |
| CAS Registry Number | 57989-42-1 |
| Molecular Structure | ![]() |
| Dichte | 1.42g/cm3 |
| Siedepunkt | 465.7°C at 760 mmHg |
| Brechungsindex | 1.695 |
| Flammpunkt | 235.4°C |
| Dampfdruck | 7.54E-09mmHg at 25°C |
| MSDS | |