ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-55-9 4-Heptanol |
|
| Produkt-Name | 4-Heptanol |
| Englischer Name | 4-Heptanol;Dipropylcarbinol;heptan-4-ol |
| Molekulare Formel | C7H16O |
| Molecular Weight | 116.2013 |
| InChl | InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| CAS Registry Number | 589-55-9 |
| EINECS | 209-651-7 |
| Molecular Structure | ![]() |
| Dichte | 0.818g/cm3 |
| Siedepunkt | 161.3°C at 760 mmHg |
| Brechungsindex | 1.42 |
| Flammpunkt | 61.8°C |
| Dampfdruck | 0.792mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R10##Flammable.||R36##Irritating to eyes.:; |
| Safety Beschreibung | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S39##Wear eye/face protection.:; |
| MSDS | |