ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6064-31-9 7-[(4-methylpiperazin-1-yl)methyl]-5-[(phenylsulfanyl)methyl]quinolin-8-ol |
|
| Produkt-Name | 7-[(4-methylpiperazin-1-yl)methyl]-5-[(phenylsulfanyl)methyl]quinolin-8-ol |
| Englischer Name | 7-[(4-methylpiperazin-1-yl)methyl]-5-[(phenylsulfanyl)methyl]quinolin-8-ol;7-(4-Methyl-piperazin-1-ylmethyl)-5-phenylsulfanylmethyl-quinolin-8-ol |
| Molekulare Formel | C22H25N3OS |
| Molecular Weight | 379.5184 |
| InChl | InChI=1/C22H25N3OS/c1-24-10-12-25(13-11-24)15-17-14-18(16-27-19-6-3-2-4-7-19)20-8-5-9-23-21(20)22(17)26/h2-9,14,26H,10-13,15-16H2,1H3 |
| CAS Registry Number | 6064-31-9 |
| Molecular Structure | ![]() |
| Dichte | 1.28g/cm3 |
| Siedepunkt | 567.6°C at 760 mmHg |
| Brechungsindex | 1.702 |
| Flammpunkt | 297.1°C |
| Dampfdruck | 1.74E-13mmHg at 25°C |
| MSDS | |