ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-31-5 Alpha,Alpha-Dibromotoluene |
|
| Produkt-Name | Alpha,Alpha-Dibromotoluene |
| Englischer Name | Alpha,Alpha-Dibromotoluene;Benzal bromide;(dibromomethyl)benzene |
| Molekulare Formel | C7H6Br2 |
| Molecular Weight | 249.9305 |
| InChl | InChI=1/C7H6Br2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| CAS Registry Number | 618-31-5 |
| EINECS | 210-543-7 |
| Molecular Structure | ![]() |
| Dichte | 1.881g/cm3 |
| Siedepunkt | 276.6°C at 760 mmHg |
| Brechungsindex | 1.619 |
| Flammpunkt | 100.2°C |
| Dampfdruck | 0.00802mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |