ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-56-4 3,5-Diaminobenzoic acid dihydrochloride | 
    |
| Produkt-Name | 3,5-Diaminobenzoic acid dihydrochloride | 
| Englischer Name | 3,5-Diaminobenzoic acid dihydrochloride;Benzoic acid, 3,5-diamino-, hydrochloride (1:2);AI3-51087;NSC 57806;Benzoic acid, 3,5-diamino-, dihydrochloride | 
| Molekulare Formel | C7H8N2O2.2HCl | 
| Molecular Weight | 225.07 | 
| InChl | InChI=1/C7H8N2O2.2ClH/c8-5-1-4(7(10)11)2-6(9)3-5;;/h1-3H,8-9H2,(H,10,11);2*1H | 
| CAS Registry Number | 618-56-4 | 
| EINECS | 210-556-8 | 
| Molecular Structure | ![]()  | 
    
| Schmelzpunkt | 300℃ | 
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |