ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6269-57-4 3-[2-(4-phenylpiperazin-1-yl)ethoxy]propanitril |
|
| Produkt-Name | 3-[2-(4-phenylpiperazin-1-yl)ethoxy]propanitril |
| Synonyme | ; |
| Englischer Name | 3-[2-(4-phenylpiperazin-1-yl)ethoxy]propanenitrile; |
| Molekulare Formel | C15H21N3O |
| Molecular Weight | 259.3467 |
| InChl | InChI=1/C15H21N3O/c16-7-4-13-19-14-12-17-8-10-18(11-9-17)15-5-2-1-3-6-15/h1-3,5-6H,4,8-14H2 |
| CAS Registry Number | 6269-57-4 |
| Molecular Structure | ![]() |
| Dichte | 1.082g/cm3 |
| Siedepunkt | 431.3°C at 760 mmHg |
| Brechungsindex | 1.537 |
| Flammpunkt | 214.6°C |
| Dampfdruck | 1.21E-07mmHg at 25°C |
| MSDS | |