ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6282-00-4 NN-Dipropylformamide |
|
Produkt-Name | NN-Dipropylformamide |
Englischer Name | NN-Dipropylformamide;N,N-Di-n-propylformamide;N,N-dipropylformamide |
Molekulare Formel | C7H15NO |
Molecular Weight | 129.2001 |
InChl | InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
CAS Registry Number | 6282-00-4 |
Molecular Structure | ![]() |
Dichte | 0.869g/cm3 |
Siedepunkt | 221.3°C at 760 mmHg |
Brechungsindex | 1.429 |
Flammpunkt | 83.7°C |
Dampfdruck | 0.108mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |