ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6322-13-0 2-{[2-(4-chlorphenyl)-1-(4-methoxyphenyl)ethyl]amino}ethanol |
|
| Produkt-Name | 2-{[2-(4-chlorphenyl)-1-(4-methoxyphenyl)ethyl]amino}ethanol |
| Synonyme | ; |
| Englischer Name | 2-{[2-(4-chlorophenyl)-1-(4-methoxyphenyl)ethyl]amino}ethanol; |
| Molekulare Formel | C17H20ClNO2 |
| Molecular Weight | 305.7992 |
| InChl | InChI=1/C17H20ClNO2/c1-21-16-8-4-14(5-9-16)17(19-10-11-20)12-13-2-6-15(18)7-3-13/h2-9,17,19-20H,10-12H2,1H3 |
| CAS Registry Number | 6322-13-0 |
| Molecular Structure | ![]() |
| Dichte | 1.18g/cm3 |
| Siedepunkt | 453.5°C at 760 mmHg |
| Brechungsindex | 1.58 |
| Flammpunkt | 228.1°C |
| Dampfdruck | 5.15E-09mmHg at 25°C |
| MSDS | |