ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
63868-89-3 2-{[(4-methylpiperazin-1-yl)methyl]sulfanyl}ethanthiol |
|
| Produkt-Name | 2-{[(4-methylpiperazin-1-yl)methyl]sulfanyl}ethanthiol |
| Synonyme | ; |
| Englischer Name | 2-{[(4-methylpiperazin-1-yl)methyl]sulfanyl}ethanethiol; |
| Molekulare Formel | C8H18N2S2 |
| Molecular Weight | 206.3719 |
| InChl | InChI=1/C8H18N2S2/c1-9-2-4-10(5-3-9)8-12-7-6-11/h11H,2-8H2,1H3 |
| CAS Registry Number | 63868-89-3 |
| Molecular Structure | ![]() |
| Dichte | 1.082g/cm3 |
| Siedepunkt | 291.7°C at 760 mmHg |
| Brechungsindex | 1.543 |
| Flammpunkt | 130.2°C |
| Dampfdruck | 0.00192mmHg at 25°C |
| MSDS | |