ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
65122-45-4 Ameisensäure, Verbindung mit 4-[(m-Aminophenyl)azo]benzol-1,3-diamin (1:1) |
|
| Produkt-Name | Ameisensäure, Verbindung mit 4-[(m-Aminophenyl)azo]benzol-1,3-diamin (1:1) |
| Synonyme | Ameisensäure, komp.mit 4-(2-(3-aminophenyl)diazenyl)-1,3-benzoldiamin (1:1); m-Phenylendiamin, 4-((m-Aminophenyl)azo)-, Monoformiat; Ameisensäure, komp.mit 4-((3-aminophenyl)azo)-1,3-benzoldiamin (1:1); Ameisensäure, Verbindung mit 4-((m-Aminophenyl)azo)benzol-1,3-diamin (1:1); Ameisensäure - 4-[(E)-(3-aminophenyl)diazenyl]benzol-1,3-diamin (1:1); |
| Englischer Name | formic acid, compound with 4-[(m-aminophenyl)azo]benzene-1,3-diamine (1:1);Formic acid, compd. with 4-(2-(3-aminophenyl)diazenyl)-1,3-benzenediamine (1:1);m-Phenylenediamine, 4-((m-aminophenyl)azo)-, monoformate;Formic acid, compd. with 4-((3-aminophenyl)azo)-1,3-benzenediamine (1:1);Formic acid, compound with 4-((m-aminophenyl)azo)benzene-1,3-diamine (1:1);formic acid - 4-[(E)-(3-aminophenyl)diazenyl]benzene-1,3-diamine (1:1) |
| Molekulare Formel | C13H15N5O2 |
| Molecular Weight | 273.2905 |
| InChl | InChI=1/C12H13N5.CH2O2/c13-8-2-1-3-10(6-8)16-17-12-5-4-9(14)7-11(12)15;2-1-3/h1-7H,13-15H2;1H,(H,2,3)/b17-16+; |
| CAS Registry Number | 65122-45-4 |
| EINECS | 265-490-2 |
| Molecular Structure | ![]() |
| Siedepunkt | 521.3°C at 760 mmHg |
| Flammpunkt | 269.1°C |
| Dampfdruck | 5.76E-11mmHg at 25°C |
| MSDS | |