ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68411-40-5 Benzene, 1,2-dimethyl-, reaction products with styrene |
|
Produkt-Name | Benzene, 1,2-dimethyl-, reaction products with styrene |
Englischer Name | Benzene, 1,2-dimethyl-, reaction products with styrene;Distyrylxylene;1,2-dimethylbenzene - ethenylbenzene (1:1) |
Molekulare Formel | C16H18 |
Molecular Weight | 210.3141 |
InChl | InChI=1/C8H10.C8H8/c1-7-5-3-4-6-8(7)2;1-2-8-6-4-3-5-7-8/h3-6H,1-2H3;2-7H,1H2 |
CAS Registry Number | 68411-40-5 |
EINECS | 270-121-3 |
Molecular Structure | ![]() |
Siedepunkt | 145.9°C at 760 mmHg |
Flammpunkt | 29.2°C |
Dampfdruck | 5.99mmHg at 25°C |
MSDS |