ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70-69-9 4'-Aminopropiophenone |
|
| Produkt-Name | 4'-Aminopropiophenone |
| Englischer Name | 4'-Aminopropiophenone;4-Aminopropiophenone;para-Aminopropiophenone;p-Aminopropiophenone |
| Molekulare Formel | C9H11NO |
| Molecular Weight | 149.1897 |
| InChl | InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| CAS Registry Number | 70-69-9 |
| EINECS | 200-742-7 |
| Molecular Structure | ![]() |
| Dichte | 1.067g/cm3 |
| Schmelzpunkt | 137-143℃ |
| Siedepunkt | 305.8°C at 760 mmHg |
| Brechungsindex | 1.559 |
| Flammpunkt | 138.7°C |
| Dampfdruck | 0.000805mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R25##Toxic if swallowed.:; |
| Safety Beschreibung | S28A##After contact with skin, wash immediately with plenty of water.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |