ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71617-21-5 4,4'-(Cyclohexan-1,3-diyl)di-o-toluidin |
|
| Produkt-Name | 4,4'-(Cyclohexan-1,3-diyl)di-o-toluidin |
| Synonyme | 4,4'-(Cyclohexan-1,3-diyl)di-o-toluidin; 4-[3-(4-Amino-3-methyl-phenyl)cyclohexyl]-2-methyl-anilin; |
| Englischer Name | 4,4'-(cyclohexane-1,3-diyl)di-o-toluidine;4,4'-(Cyclohexane-1,3-diyl)di-o-toluidine;4-[3-(4-amino-3-methyl-phenyl)cyclohexyl]-2-methyl-aniline |
| Molekulare Formel | C20H26N2 |
| Molecular Weight | 294.4338 |
| InChl | InChI=1/C20H26N2/c1-13-10-17(6-8-19(13)21)15-4-3-5-16(12-15)18-7-9-20(22)14(2)11-18/h6-11,15-16H,3-5,12,21-22H2,1-2H3 |
| CAS Registry Number | 71617-21-5 |
| EINECS | 275-714-0 |
| Molecular Structure | ![]() |
| Dichte | 1.082g/cm3 |
| Siedepunkt | 488.6°C at 760 mmHg |
| Brechungsindex | 1.613 |
| Flammpunkt | 299.6°C |
| Dampfdruck | 1.07E-09mmHg at 25°C |
| MSDS | |