ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
| Produkt-Name | Bromodichloromethane |
| Englischer Name | Bromodichloromethane;FC-20B1 |
| Molekulare Formel | CHBrCl2 |
| Molecular Weight | 163.8286 |
| InChl | InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS Registry Number | 75-27-4 |
| EINECS | 200-856-7 |
| Molecular Structure | ![]() |
| Dichte | 2.013g/cm3 |
| Schmelzpunkt | -55℃ |
| Siedepunkt | 89.7°C at 760 mmHg |
| Brechungsindex | 1.503 |
| Flammpunkt | 1.3°C |
| Dampfdruck | 65.3mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |