ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75198-38-8 1,2,3,6,8,9-Hexachlordibenzo[b,d]furan |
|
| Produkt-Name | 1,2,3,6,8,9-Hexachlordibenzo[b,d]furan |
| Synonyme | 1,2,3,6,8,9-HEXACHLORDIBENZOFURAN; Dibenzofuran, 1,2,3,6,8,9-hexachlor; Dibenzofuran, 1,2,3,6,8,9-hexachlor-; |
| Englischer Name | 1,2,3,6,8,9-hexachlorodibenzo[b,d]furan;1,2,3,6,8,9-HEXACHLORODIBENZOFURAN;Dibenzofuran, 1,2,3,6,8,9-hexachloro;dibenzofuran, 1,2,3,6,8,9-hexachloro- |
| Molekulare Formel | C12H2Cl6O |
| Molecular Weight | 374.8617 |
| InChl | InChI=1/C12H2Cl6O/c13-3-1-5(15)12-8(9(3)16)7-6(19-12)2-4(14)10(17)11(7)18/h1-2H |
| CAS Registry Number | 75198-38-8 |
| Molecular Structure | ![]() |
| Dichte | 1.766g/cm3 |
| Siedepunkt | 474.3°C at 760 mmHg |
| Brechungsindex | 1.717 |
| Flammpunkt | 240.6°C |
| Dampfdruck | 1.05E-08mmHg at 25°C |
| MSDS | |