ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76206-37-6 naphthalen-1-yl nitroso(propyl)carbamate |
|
| Produkt-Name | naphthalen-1-yl nitroso(propyl)carbamate |
| Englischer Name | naphthalen-1-yl nitroso(propyl)carbamate; |
| Molekulare Formel | C14H14N2O3 |
| Molecular Weight | 258.2726 |
| InChl | InChI=1/C14H14N2O3/c1-2-10-16(15-18)14(17)19-13-9-5-7-11-6-3-4-8-12(11)13/h3-9H,2,10H2,1H3 |
| CAS Registry Number | 76206-37-6 |
| Molecular Structure | ![]() |
| Dichte | 1.19g/cm3 |
| Siedepunkt | 378°C at 760 mmHg |
| Brechungsindex | 1.577 |
| Flammpunkt | 182.4°C |
| Dampfdruck | 6.49E-06mmHg at 25°C |
| MSDS | |