ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77382-78-6 3-hydroxy-4-[methyl(nitroso)amino]butanoic acid |
|
| Produkt-Name | 3-hydroxy-4-[methyl(nitroso)amino]butanoic acid |
| Englischer Name | 3-hydroxy-4-[methyl(nitroso)amino]butanoic acid; |
| Molekulare Formel | C5H10N2O4 |
| Molecular Weight | 162.1439 |
| InChl | InChI=1/C5H10N2O4/c1-7(6-11)3-4(8)2-5(9)10/h4,8H,2-3H2,1H3,(H,9,10) |
| CAS Registry Number | 77382-78-6 |
| Molecular Structure | ![]() |
| Dichte | 1.38g/cm3 |
| Siedepunkt | 441.2°C at 760 mmHg |
| Brechungsindex | 1.525 |
| Flammpunkt | 220.6°C |
| Dampfdruck | 1.23E-09mmHg at 25°C |
| MSDS | |