ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
79759-42-5 6-Brom-1-phenyl-1,3-dihydro-2H-benzimidazol-2-on |
|
| Produkt-Name | 6-Brom-1-phenyl-1,3-dihydro-2H-benzimidazol-2-on |
| Englischer Name | 6-bromo-1-phenyl-1,3-dihydro-2H-benzimidazol-2-one; |
| Molekulare Formel | C13H9BrN2O |
| Molecular Weight | 289.1274 |
| InChl | InChI=1/C13H9BrN2O/c14-9-6-7-11-12(8-9)16(13(17)15-11)10-4-2-1-3-5-10/h1-8H,(H,15,17) |
| CAS Registry Number | 79759-42-5 |
| Molecular Structure | ![]() |
| Dichte | 1.584g/cm3 |
| Brechungsindex | 1.672 |
| MSDS | |