ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88351-78-4 4-Nitro-N-[4-({2-[(Z)-(6-Oxocyclohexa-2,4-dien-1-yliden)methyl]hydrazino}carbonyl)phenyl]benzamid |
|
| Produkt-Name | 4-Nitro-N-[4-({2-[(Z)-(6-Oxocyclohexa-2,4-dien-1-yliden)methyl]hydrazino}carbonyl)phenyl]benzamid |
| Synonyme | ; |
| Englischer Name | 4-nitro-N-[4-({2-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]hydrazino}carbonyl)phenyl]benzamide; |
| Molekulare Formel | C21H16N4O5 |
| Molecular Weight | 404.3755 |
| InChl | InChI=1/C21H16N4O5/c26-19-4-2-1-3-16(19)13-22-24-21(28)15-5-9-17(10-6-15)23-20(27)14-7-11-18(12-8-14)25(29)30/h1-13,22H,(H,23,27)(H,24,28)/b16-13- |
| CAS Registry Number | 88351-78-4 |
| Molecular Structure | ![]() |
| Dichte | 1.473g/cm3 |
| Siedepunkt | 551.6°C at 760 mmHg |
| Brechungsindex | 1.744 |
| Flammpunkt | 287.4°C |
| Dampfdruck | 3.27E-12mmHg at 25°C |
| MSDS | |