ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94086-70-1 Dibutyl-2,2'-trithiodiacetat |
|
| Produkt-Name | Dibutyl-2,2'-trithiodiacetat |
| Synonyme | Dibutyl-2,2'-trithiodiacetat; Butyl-2-(2-butoxy-2-oxo-ethyl)sulfanyldisulfanylacetat; |
| Englischer Name | dibutyl 2,2'-trithiodiacetate;Dibutyl 2,2'-trithiodiacetate;butyl 2-(2-butoxy-2-oxo-ethyl)sulfanyldisulfanylacetate |
| Molekulare Formel | C12H22O4S3 |
| Molecular Weight | 326.4957 |
| InChl | InChI=1/C12H22O4S3/c1-3-5-7-15-11(13)9-17-19-18-10-12(14)16-8-6-4-2/h3-10H2,1-2H3 |
| CAS Registry Number | 94086-70-1 |
| EINECS | 301-859-7 |
| Molecular Structure | ![]() |
| Dichte | 1.185g/cm3 |
| Siedepunkt | 409.8°C at 760 mmHg |
| Brechungsindex | 1.53 |
| Flammpunkt | 190.3°C |
| Dampfdruck | 6.33E-07mmHg at 25°C |
| MSDS | |