ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
951-55-3 5-Methyl-DL-tryptophan |
|
Produkt-Name | 5-Methyl-DL-tryptophan |
Englischer Name | 5-Methyl-DL-tryptophan; |
Molekulare Formel | C12H14N2O2 |
Molecular Weight | 218.2518 |
InChl | InChI=1/C12H14N2O2/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m1/s1 |
CAS Registry Number | 951-55-3 |
EINECS | 213-453-6 |
Molecular Structure | ![]() |
Dichte | 1.313g/cm3 |
Schmelzpunkt | 280-282℃ |
Siedepunkt | 455.1°C at 760 mmHg |
Brechungsindex | 1.677 |
Flammpunkt | 229.1°C |
Dampfdruck | 4.48E-09mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |