ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea |
|
| Produkt-Name | 3,5-Dimethylphenylthiourea |
| Englischer Name | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
| Molekulare Formel | C9H12N2S |
| Molecular Weight | 180.27 |
| InChl | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| CAS Registry Number | 97480-60-9 |
| Molecular Structure | ![]() |
| Dichte | 1.2g/cm3 |
| Siedepunkt | 293.9°C at 760 mmHg |
| Brechungsindex | 1.674 |
| Flammpunkt | 131.5°C |
| Dampfdruck | 0.00168mmHg at 25°C |
| Risk Codes | R25##Toxic if swallowed.:; |
| Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |