ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98335-17-2 3,5-Diaminobenzhydrazid |
|
Produkt-Name | 3,5-Diaminobenzhydrazid |
Synonyme | 3,5-Diaminobenzohydrazid; |
Englischer Name | 3,5-Diaminobenzhydrazide;3,5-diaminobenzohydrazide |
Molekulare Formel | C7H10N4O |
Molecular Weight | 166.1805 |
InChl | InChI=1/C7H10N4O/c8-5-1-4(7(12)11-10)2-6(9)3-5/h1-3H,8-10H2,(H,11,12) |
CAS Registry Number | 98335-17-2 |
Molecular Structure | ![]() |
Dichte | 1.367g/cm3 |
Brechungsindex | 1.705 |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |