ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
100-81-2 3-Methylbenzylamine |
|
| Chemical Name | 3-Methylbenzylamine |
| Synonyms | m-Xylylamine;Methylbenzylamine;3-Methylbenzylbenzylamine;3-Xylylamine;1-(3-methylphenyl)methanamine;(3-methylphenyl)methanaminium;3-Methylbenzyl amine |
| Molecular Formula | C8H12N |
| Molecular Weight | 122.187 |
| InChl | InChI=1/C8H11N/c1-7-3-2-4-8(5-7)6-9/h2-5H,6,9H2,1H3/p+1 |
| CAS Registry Number | 100-81-2 |
| EINECS | 202-890-8 |
| Molecular Structure | ![]() |
| Boiling Point | 200.2°C at 760 mmHg |
| Flash Point | 80.6°C |
| Vapour Pressur | 0.329mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R34:; |
| Safety Description | S26||S36/37/39||S45:; |
| MSDS | |