ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
108-57-6 1,3-divinylbenzene |
|
| Chemical Name | 1,3-divinylbenzene |
| Synonyms | 1,3-Diethenylbenzene;1,3-Divinylbenzene;3-05-00-01367 (Beilstein Handbook Reference);BRN 1848732;m-Divinylbenzen;m-Divinylbenzen [Czech];m-Divinylbenzene;m-Vinylstyrene;Benzene, 1,3-diethenyl-;Benzene, 1,3-diethenyl- (9CI);Benzene, m-divinyl-;m-Divinyl benzene |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.1864 |
| InChl | InChI=1/C10H10/c1-3-9-6-5-7-10(4-2)8-9/h3-8H,1-2H2 |
| CAS Registry Number | 108-57-6 |
| EINECS | 203-595-7 |
| Molecular Structure | ![]() |
| Density | 0.921g/cm3 |
| Boiling Point | 211.3°C at 760 mmHg |
| Refractive Index | 1.596 |
| Flash Point | 74.6°C |
| Vapour Pressur | 0.266mmHg at 25°C |
| MSDS | |