ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110-36-1 butyl myristate |
|
Chemical Name | butyl myristate |
Synonyms | n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester;Myristicacidnbutylester;Myristic acid n-butyl ester;butyl tetradecanoate |
Molecular Formula | C18H36O2 |
Molecular Weight | 284.4772 |
InChl | InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
CAS Registry Number | 110-36-1 |
EINECS | 203-759-8 |
Molecular Structure | ![]() |
Density | 0.864g/cm3 |
Boiling Point | 334.7°C at 760 mmHg |
Refractive Index | 1.442 |
Flash Point | 158.5°C |
Vapour Pressur | 0.000126mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |