ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
322-97-4 7-(Trifluoromethyl)-4-quinolinol |
|
| Chemical Name | 7-(Trifluoromethyl)-4-quinolinol |
| Synonyms | 4-Hydroxy-7-(trifluoromethyl)quinoline;7-(trifluoromethyl)quinolin-4-ol |
| Molecular Formula | C15H8F3NO |
| Molecular Weight | 275.2253 |
| InChl | InChI=1/C15H8F3NO/c16-11-4-3-9(14(17)15(11)18)8-1-2-10-12(7-8)19-6-5-13(10)20/h1-7H,(H,19,20) |
| CAS Registry Number | 322-97-4 |
| EINECS | 206-298-0 |
| Molecular Structure | ![]() |
| Melting Point | 266-269℃ |
| Refractive Index | 1.629 |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |