ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
330-94-9 4-(4-Fluorophenyl)-3-thiosemicarbazide |
|
| Chemical Name | 4-(4-Fluorophenyl)-3-thiosemicarbazide |
| Synonyms | N-(4-fluorophenyl)hydrazinecarbothioamide |
| Molecular Formula | C7H8FN3S |
| Molecular Weight | 185.2219 |
| InChl | InChI=1/C7H8FN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
| CAS Registry Number | 330-94-9 |
| Molecular Structure | ![]() |
| Density | 1.418g/cm3 |
| Boiling Point | 285°C at 760 mmHg |
| Refractive Index | 1.696 |
| Flash Point | 126.2°C |
| Vapour Pressur | 0.00287mmHg at 25°C |
| Risk Codes | R25##Toxic if swallowed.:; |
| Safety Description | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |