ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
350-90-3 Alpha-Fluorocinnamic acid |
|
| Chemical Name | Alpha-Fluorocinnamic acid |
| Synonyms | Cinnamic acid, alpha-fluoro-;1-09-00-00237 (Beilstein Handbook Reference);2-Fluoro-3-phenyl-2-propenoic acid;BRN 2501318;NSC 102780;alpha-Fluorocinnamic acid;2-Propenoic acid, 2-fluoro-3-phenyl- (9CI);2-fluoro-3-phenylprop-2-enoic acid;(2Z)-2-fluoro-3-phenylprop-2-enoate;(2Z)-2-fluoro-3-phenylprop-2-enoic acid |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.1491 |
| InChl | InChI=1/C9H7FO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6H,(H,11,12)/b8-6- |
| CAS Registry Number | 350-90-3 |
| EINECS | 206-508-0 |
| Molecular Structure | ![]() |
| Density | 1.275g/cm3 |
| Melting Point | 156-160℃ |
| Boiling Point | 289.3°C at 760 mmHg |
| Refractive Index | 1.585 |
| Flash Point | 128.7°C |
| Vapour Pressur | 0.00103mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |