ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
501-24-6 3-n-Pentadecylphenol |
|
| Chemical Name | 3-n-Pentadecylphenol |
| Synonyms | Pentadecylphenol;3-pentadecylphenol;3-Pentadecyl phenol |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.5099 |
| InChl | InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
| CAS Registry Number | 501-24-6 |
| EINECS | 207-921-9 |
| Molecular Structure | ![]() |
| Density | 0.908g/cm3 |
| Melting Point | 47-53℃ |
| Boiling Point | 402°C at 760 mmHg |
| Refractive Index | 1.495 |
| Flash Point | 246.3°C |
| Vapour Pressur | 4.88E-07mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |