ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
519-66-4 4-hydroxy-1-methyl-3-phenyl-1,2-dihydroquinolin-2-one |
|
| Chemical Name | 4-hydroxy-1-methyl-3-phenyl-1,2-dihydroquinolin-2-one |
| Synonyms | 2-hydroxy-1-methyl-3-phenylquinolin-4(1H)-one;4-hydroxy-1-methyl-3-phenylquinolin-2(1H)-one |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.2799 |
| InChl | InChI=1/C16H13NO2/c1-17-13-10-6-5-9-12(13)15(18)14(16(17)19)11-7-3-2-4-8-11/h2-10,18H,1H3 |
| CAS Registry Number | 519-66-4 |
| Molecular Structure | ![]() |
| Density | 1.293g/cm3 |
| Melting Point | 225℃ |
| Boiling Point | 403.67°C at 760 mmHg |
| Refractive Index | 1.669 |
| Flash Point | 197.933°C |
| Vapour Pressur | 0mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |