ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-40-5 1-(1-benzothiophen-3-yl)-3-(dimethylamino)propan-1-one |
|
| Chemical Name | 1-(1-benzothiophen-3-yl)-3-(dimethylamino)propan-1-one |
| Synonyms | 1-(1-benzothiophen-3-yl)-3-(dimethylamino)propan-1-one hydrochloride (1:1);1-Propanone, 1-benzo(b)thien-3-yl-3-(dimethylamino)-, hydrochloride |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.3293 |
| InChl | InChI=1/C13H15NOS/c1-14(2)8-7-12(15)11-9-16-13-6-4-3-5-10(11)13/h3-6,9H,7-8H2,1-2H3 |
| CAS Registry Number | 61-40-5 |
| Molecular Structure | ![]() |
| Density | 1.158g/cm3 |
| Boiling Point | 368.5°C at 760 mmHg |
| Refractive Index | 1.613 |
| Flash Point | 176.7°C |
| Vapour Pressur | 1.27E-05mmHg at 25°C |
| MSDS | |