ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-76-7 L(-)-Phenylephrine hydrochloride |
|
| Chemical Name | L(-)-Phenylephrine hydrochloride |
| Synonyms | 3-Hydroxy-alpha-(methylaminomethyl)benzyl alcohol hydrochloride;L-Phenylephrine hydrochloride;(R)-3-Hydroxy-alpha-(methylaminomethyl)benzyl alcohol hydrochloride;Phenylephrine HCL;PHENYLEPHRINE HYDROCHLORIDE;(R)-(-)-1-(3-Hydroxyphenyl)-2-methylaminoethanol hydrochloride;d-(-)-phenylephrinehydrochloride;Phenylephrine Hydrochloride |
| Molecular Formula | C9H15Cl2NO2 |
| Molecular Weight | 240.1269 |
| InChl | InChI=1/C9H13NO2.2ClH/c1-10-6-9(12)7-3-2-4-8(11)5-7;;/h2-5,9-12H,6H2,1H3;2*1H/t9-;;/m0../s1 |
| CAS Registry Number | 61-76-7 |
| EINECS | 200-517-3 |
| Molecular Structure | ![]() |
| Melting Point | 140-145℃ |
| Water Solubility | >=10 g/100 mL at 21℃ |
| Hazard Symbols | |
| Risk Codes | R22||R36/37/38:; |
| Safety Description | S26||S37/39:; |
| MSDS | |