ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-23-4 2-Nitrosotoluene |
|
| Chemical Name | 2-Nitrosotoluene |
| Synonyms | 1-Methyl-2-nitrosobenzene;2-Methyl-1-nitrosobenzene;2-Methylnitrosobenzene;4-05-00-00844 (Beilstein Handbook Reference);BRN 1927295;CCRIS 480;NSC 66507;o-Methylnitrosobenzene;o-Nitrosotoluene;Benzene, 1-methyl-2-nitroso- (9CI);Toluene, o-nitroso- |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.1366 |
| InChl | InChI=1/C7H7NO/c1-6-4-2-3-5-7(6)8-9/h2-5H,1H3 |
| CAS Registry Number | 611-23-4 |
| EINECS | 210-261-4 |
| Molecular Structure | ![]() |
| Density | 1.03g/cm3 |
| Melting Point | 70-75℃ |
| Boiling Point | 199.9°C at 760 mmHg |
| Refractive Index | 1.524 |
| Flash Point | 74.7°C |
| Vapour Pressur | 0.472mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |