ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
80-10-4 Dichlorodiphenylsilane |
|
| Chemical Name | Dichlorodiphenylsilane |
| Synonyms | Diphenyldichlorosilane;Diphenylsilyl dichloride;Diphenyl dichlorosilicane;dichlorodiphenyl-silane;dichlor-difenylsilane;DPDCS |
| Molecular Formula | C12H12Cl2Si |
| Molecular Weight | 255.2152 |
| InChl | InChI=1/C12H10.Cl2H2Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1-10H;3H2 |
| CAS Registry Number | 80-10-4 |
| EINECS | 201-251-0 |
| Molecular Structure | ![]() |
| Melting Point | -22℃ |
| Water Solubility | DECOMPOSES |
| Hazard Symbols | |
| Risk Codes | R22||R24||R34:; |
| Safety Description | S26||S28A||S36/37/39||S45:; |
| MSDS | |