ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-84-5 1,8-Naphthalic anhydride |
|
| Chemical Name | 1,8-Naphthalic anhydride |
| Molecular Formula | C12H6O3 |
| Molecular Weight | 198.17 |
| InChl | InChI=1S/C12H6O3/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11/h1-6H |
| CAS Registry Number | 81-84-5 |
| EINECS | 201-380-2 |
| Molecular Structure | ![]() |
| Melting Point | 267-269℃ |
| Refractive Index | 1.736 |
| Flash Point | 272℃ |
| Water Solubility | decomposes |
| Safety Description | S24/25:; |
| MSDS | |