ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-02-0 khellin |
|
| Chemical Name | khellin |
| Synonyms | 4,9-dimethoxy-7-methylfurano(3,2-g)chromen-5-one;4,9-dimethoxy-7-methyl-5H-furo[3,2-g]chromen-5-one |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.2421 |
| InChl | InChI=1/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3 |
| CAS Registry Number | 82-02-0 |
| EINECS | 201-392-8 |
| Molecular Structure | ![]() |
| Density | 1.301g/cm3 |
| Melting Point | 150-154℃ |
| Boiling Point | 482.1°C at 760 mmHg |
| Refractive Index | 1.595 |
| Flash Point | 218.8°C |
| Vapour Pressur | 1.88E-09mmHg at 25°C |
| MSDS | |