ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-10-0 sumatrol |
|
| Chemical Name | sumatrol |
| Synonyms | Sumatrol;(1)Benzopyrano(3,4-b)furo(2,3-h)(1)benzopyran-6(6aH)-one, 1,2,12,12a-tetrahydro-5-hydroxy-2-isopropenyl-8,9-dimethoxy-, (-)-;(2R,6aS,12aS)-5-hydroxy-8,9-dimethoxy-2-(prop-1-en-2-yl)-1,2,12,12a-tetrahydrochromeno[3,4-b]furo[2,3-h]chromen-6(6aH)-one |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.4166 |
| InChl | InChI=1/C23H22O7/c1-10(2)14-6-12-16(29-14)7-13(24)21-22(25)20-11-5-17(26-3)18(27-4)8-15(11)28-9-19(20)30-23(12)21/h5,7-8,14,19-20,24H,1,6,9H2,2-4H3/t14-,19-,20+/m1/s1 |
| CAS Registry Number | 82-10-0 |
| Molecular Structure | ![]() |
| Density | 1.329g/cm3 |
| Boiling Point | 606.8°C at 760 mmHg |
| Refractive Index | 1.608 |
| Flash Point | 212.8°C |
| Vapour Pressur | 2.55E-15mmHg at 25°C |
| MSDS | |