ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-16-6 1,8-bis[(4-methylphenyl)amino]anthraquinone |
|
| Chemical Name | 1,8-bis[(4-methylphenyl)amino]anthraquinone |
| Synonyms | 9,10-Anthracenedione, 1,8-bis((4-methylphenyl)amino)-;1,8-Bis((4-methylphenyl)amino)-9,10-anthracenedione;1,8-p-Toluidinoanthraquinone;1,8-Bis((4-methylphenyl)amino)anthraquinone;1,8-bis[(4-methylphenyl)amino]anthracene-9,10-dione |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.4865 |
| InChl | InChI=1/C28H22N2O2/c1-17-9-13-19(14-10-17)29-23-7-3-5-21-25(23)28(32)26-22(27(21)31)6-4-8-24(26)30-20-15-11-18(2)12-16-20/h3-16,29-30H,1-2H3 |
| CAS Registry Number | 82-16-6 |
| EINECS | 201-398-0 |
| Molecular Structure | ![]() |
| Density | 1.292g/cm3 |
| Boiling Point | 633.8°C at 760 mmHg |
| Refractive Index | 1.714 |
| Flash Point | 197°C |
| Vapour Pressur | 5.73E-16mmHg at 25°C |
| MSDS | |