ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-21-3 1,5-Diphenoxyanthraquinone |
|
| Chemical Name | 1,5-Diphenoxyanthraquinone |
| Synonyms | 1,5-Diphenoxy-9,10-Anthracenedione;1,5-diphenoxyanthracene-9,10-dione |
| Molecular Formula | C26H16O4 |
| Molecular Weight | 392.4028 |
| InChl | InChI=1/C26H16O4/c27-25-20-14-8-16-22(30-18-11-5-2-6-12-18)24(20)26(28)19-13-7-15-21(23(19)25)29-17-9-3-1-4-10-17/h1-16H |
| CAS Registry Number | 82-21-3 |
| EINECS | 201-404-1 |
| Molecular Structure | ![]() |
| Density | 1.306g/cm3 |
| Boiling Point | 566.7°C at 760 mmHg |
| Refractive Index | 1.665 |
| Flash Point | 247.2°C |
| Vapour Pressur | 7.36E-13mmHg at 25°C |
| MSDS | |