ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-45-1 1-Aminoanthraquinone |
|
| Chemical Name | 1-Aminoanthraquinone |
| Synonyms | 1-Amino anthraquinone;1-Amino Anthraquinon |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.2268 |
| InChl | InChI=1/C14H9NO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H,15H2 |
| CAS Registry Number | 82-45-1 |
| EINECS | 201-423-5 |
| Molecular Structure | ![]() |
| Density | 1.383g/cm3 |
| Melting Point | 251℃ |
| Boiling Point | 464.9°C at 760 mmHg |
| Refractive Index | 1.707 |
| Flash Point | 235°C |
| Vapour Pressur | 8.04E-09mmHg at 25°C |
| Safety Description | S24/25:; |
| MSDS | |