ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-34-1 3-Methylindole |
|
| Chemical Name | 3-Methylindole |
| Synonyms | Skatole;3-Methyl-1H-indole;3-Methyl indole;3-Methyindole;SKATOL;FEMA 3019;BETA-METHYLINDOLE |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.1745 |
| InChl | InChI=1/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 |
| CAS Registry Number | 83-34-1 |
| EINECS | 201-471-7 |
| Molecular Structure | ![]() |
| Density | 1.11g/cm3 |
| Melting Point | 95-98℃ |
| Boiling Point | 265.1°C at 760 mmHg |
| Refractive Index | 1.654 |
| Flash Point | 112.5°C |
| Vapour Pressur | 0.0153mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:; |
| Safety Description | S26||S36:; |
| MSDS | |