ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-74-9 12-methoxyibogamine |
|
| Chemical Name | 12-methoxyibogamine |
| Synonyms | Ibogaine;(-)-Ibogaine;12-Methoxyibogamine;Endabuse;Ibogain;NIH 10567;NSC 249764;UNII-3S814I130U;Ibogaine (8CI);Ibogamine, 12-methoxy-;7-Ethyl-6,6beta,7,8,9,10,12,13-octahydro-2-methoxy-6,9-methano-5H-pyrido(1',2':1,2)azepino(5,4-b)indole;DEA No. 7260;Tabernanthe iboga |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.4332 |
| InChl | InChI=1/C20H26N2O/c1-3-13-8-12-9-17-19-15(6-7-22(11-12)20(13)17)16-10-14(23-2)4-5-18(16)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t12-,13+,17+,20+/m1/s1 |
| CAS Registry Number | 83-74-9 |
| EINECS | 201-498-4 |
| Molecular Structure | ![]() |
| Density | 1.2g/cm3 |
| Boiling Point | 484.2°C at 760 mmHg |
| Refractive Index | 1.643 |
| Flash Point | 246.6°C |
| Vapour Pressur | 1.57E-09mmHg at 25°C |
| MSDS | |