ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-79-4 Rotenone |
|
| Chemical Name | Rotenone |
| Synonyms | (2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno(3,4-b)furo(2,3-h)chromen-6-one; tubatoxin ;8,9-dimethoxy-2-(prop-1-en-2-yl)-1,2,12,12a-tetrahydrochromeno[3,4-b]furo[2,3-h]chromen-6(6aH)-one;(2R,6aS,12aS)-8,9-dimethoxy-2-(prop-1-en-2-yl)-1,2,12,12a-tetrahydrochromeno[3,4-b]furo[2,3-h]chromen-6(6aH)-one;(2R,6aS,12aR)-8,9-dimethoxy-2-(1-methylethenyl)-1,2,12,12a-tetrahydrochromeno[3,4-b]furo[2,3-h]chromen-6(6aH)-one |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.4172 |
| InChl | InChI=1/C23H22O6/c1-11(2)16-8-14-15(28-16)6-5-12-22(24)21-13-7-18(25-3)19(26-4)9-17(13)27-10-20(21)29-23(12)14/h5-7,9,16,20-21H,1,8,10H2,2-4H3/t16-,20+,21+/m1/s1 |
| CAS Registry Number | 83-79-4 |
| EINECS | 201-501-9 |
| Molecular Structure | ![]() |
| Density | 1.271g/cm3 |
| Melting Point | 159-164℃ |
| Boiling Point | 559.8°C at 760 mmHg |
| Refractive Index | 1.591 |
| Flash Point | 244.7°C |
| Vapour Pressur | 1.45E-12mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R25||R36/37/38||R50/53:; |
| Safety Description | S22||S24/25||S36||S45||S60||S61:; |
| MSDS | |