ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-88-5 Riboflavin |
|
| Chemical Name | Riboflavin |
| Synonyms | Lactoflavine;E 101;Riboflavin (1.07609);Riboflavine;Vitamin B_2;Vitamin B2;VB2;1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)pentitol;5-deoxy-5-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol;1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol;VITAMIN G |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.3639 |
| InChl | InChI=1/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 |
| CAS Registry Number | 83-88-5;69680-01-9 |
| EINECS | 201-507-1 |
| Molecular Structure | ![]() |
| Density | 1.65g/cm3 |
| Melting Point | 290℃ |
| Refractive Index | 1.733 |
| Water Solubility | 0.07 g/L (20℃) |
| Safety Description | S24/25:; |
| MSDS | |