ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-13-9 hexane-3,4-diylbis-2-methylbenzene-4,1-diyl dipropanoate |
|
| Chemical Name | hexane-3,4-diylbis-2-methylbenzene-4,1-diyl dipropanoate |
| Synonyms | 4,4'-(1,2-Diethyl-1,2-ethanediyl)bis[2-methylphenol] Dipropanoate;84-13-9;PROMETHESTROL DIPROPIONATE |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.5458 |
| InChl | InChI=1/C26H34O4/c1-7-21(19-11-13-23(17(5)15-19)29-25(27)9-3)22(8-2)20-12-14-24(18(6)16-20)30-26(28)10-4/h11-16,21-22H,7-10H2,1-6H3 |
| CAS Registry Number | 84-13-9 |
| Molecular Structure | ![]() |
| Density | 1.049g/cm3 |
| Boiling Point | 486.2°C at 760 mmHg |
| Refractive Index | 1.527 |
| Flash Point | 232.3°C |
| Vapour Pressur | 1.32E-09mmHg at 25°C |
| MSDS | |